C22H27N3O2 — CID 108876718
1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(4-phenylbutyl)urea (PubChem CID 108876718) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(4-phenylbutyl)urea.
| Compound Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 108876718 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(4-phenylbutyl)urea |
| SMILES | O=C(NCCCCc1ccccc1)NC1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O2/c26-21-15-20(17-25(21)16-19-12-5-2-6-13-19)24-22(27)23-14-8-7-11-18-9-3-1-4-10-18/h1-6,9-10,12-13,20H,7-8,11,14-17H2,(H2,23,24,27) |
| InChIKey | RBVJVLJQRKTYBE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|