C14H20N2O — CID 108887631
1-cyclopropyl-3-(4-phenylbutyl)urea (PubChem CID 108887631) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-phenylbutyl)urea.
| Compound Name | 1-cyclopropyl-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 108887631 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-cyclopropyl-3-(4-phenylbutyl)urea |
| SMILES | O=C(NCCCCc1ccccc1)NC1CC1 |
| InChI | InChI=1S/C14H20N2O/c17-14(16-13-9-10-13)15-11-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H2,15,16,17) |
| InChIKey | JUZZJVVTCNHBCI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|