C15H23NO2 — CID 90271205
8-phenyloctylcarbamic acid (PubChem CID 90271205) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 8-phenyloctylcarbamic acid.
| Compound Name | 8-phenyloctylcarbamic acid |
|---|---|
| PubChem CID | 90271205 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 8-phenyloctylcarbamic acid |
| SMILES | O=C(O)NCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c17-15(18)16-13-9-4-2-1-3-6-10-14-11-7-5-8-12-14/h5,7-8,11-12,16H,1-4,6,9-10,13H2,(H,17,18) |
| InChIKey | YUWBGADGCRTHLT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|