C26H28F8N2O2 — CID 3286947
2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(4-phenylbutyl)hexanediamide (PubChem CID 3286947) has the molecular formula C26H28F8N2O2 and a molecular weight of 552.51 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(4-phenylbutyl)hexanediamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(4-phenylbutyl)hexanediamide |
|---|---|
| PubChem CID | 3286947 |
| Molecular Formula | C26H28F8N2O2 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(4-phenylbutyl)hexanediamide |
| SMILES | O=C(NCCCCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C26H28F8N2O2/c27-23(28,21(37)35-17-9-7-15-19-11-3-1-4-12-19)25(31,32)26(33,34)24(29,30)22(38)36-18-10-8-16-20-13-5-2-6-14-20/h1-6,11-14H,7-10,15-18H2,(H,35,37)(H,36,38) |
| InChIKey | CRTJEOZORIUHHE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|