C18H14F22N2O2 — CID 177421303
2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-[6-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoylamino)hexyl]hexanamide (PubChem CID 177421303) has the molecular formula C18H14F22N2O2 and a molecular weight of 708.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-[6-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoylamino)hexyl]hexanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-[6-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoylamino)hexyl]hexanamide |
|---|---|
| PubChem CID | 177421303 |
| Molecular Formula | C18H14F22N2O2 |
| Molecular Weight | 708.28 g/mol |
| Exact Mass | 708.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluoro-N-[6-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoylamino)hexyl]hexanamide |
| SMILES | O=C(NCCCCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H14F22N2O2/c19-9(20,11(23,24)13(27,28)15(31,32)17(35,36)37)7(43)41-5-3-1-2-4-6-42-8(44)10(21,22)12(25,26)14(29,30)16(33,34)18(38,39)40/h1-6H2,(H,41,43)(H,42,44) |
| InChIKey | AYEUSKREGLQNQA-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.28 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|