C15H16F14N2O2 — CID 3089717
2,2,3,3,4,4,4-heptafluoro-N-[7-(2,2,3,3,4,4,4-heptafluorobutanoylamino)heptyl]butanamide (PubChem CID 3089717) has the molecular formula C15H16F14N2O2 and a molecular weight of 522.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[7-(2,2,3,3,4,4,4-heptafluorobutanoylamino)heptyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[7-(2,2,3,3,4,4,4-heptafluorobutanoylamino)heptyl]butanamide |
|---|---|
| PubChem CID | 3089717 |
| Molecular Formula | C15H16F14N2O2 |
| Molecular Weight | 522.28 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[7-(2,2,3,3,4,4,4-heptafluorobutanoylamino)heptyl]butanamide |
| SMILES | O=C(NCCCCCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H16F14N2O2/c16-10(17,12(20,21)14(24,25)26)8(32)30-6-4-2-1-3-5-7-31-9(33)11(18,19)13(22,23)15(27,28)29/h1-7H2,(H,30,32)(H,31,33) |
| InChIKey | KZLPNNQSMROFMJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|