C15H12F17NO3 — CID 14496524
6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)hexanoic acid (PubChem CID 14496524) has the molecular formula C15H12F17NO3 and a molecular weight of 577.23 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)hexanoic acid.
| Compound Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 14496524 |
| Molecular Formula | C15H12F17NO3 |
| Molecular Weight | 577.23 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H12F17NO3/c16-8(17,7(36)33-5-3-1-2-4-6(34)35)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h1-5H2,(H,33,36)(H,34,35) |
| InChIKey | OXLJKMOBNCDSML-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.23 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|