C22H36F8N2O2 — CID 4134116
2,2,3,3,4,4,5,5-octafluoro-N,N'-dioctylhexanediamide (PubChem CID 4134116) has the molecular formula C22H36F8N2O2 and a molecular weight of 512.53 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N,N'-dioctylhexanediamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-dioctylhexanediamide |
|---|---|
| PubChem CID | 4134116 |
| Molecular Formula | C22H36F8N2O2 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-dioctylhexanediamide |
| SMILES | CCCCCCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NCCCCCCCC |
| InChI | InChI=1S/C22H36F8N2O2/c1-3-5-7-9-11-13-15-31-17(33)19(23,24)21(27,28)22(29,30)20(25,26)18(34)32-16-14-12-10-8-6-4-2/h3-16H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | VBHJPANDWZVBLF-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|