C25H16F34N2O2 — CID 3089716
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[7-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)heptyl]nonanamide (PubChem CID 3089716) has the molecular formula C25H16F34N2O2 and a molecular weight of 1022.35 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[7-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)heptyl]nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[7-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)heptyl]nonanamide |
|---|---|
| PubChem CID | 3089716 |
| Molecular Formula | C25H16F34N2O2 |
| Molecular Weight | 1022.35 g/mol |
| Exact Mass | 1022.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[7-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoylamino)heptyl]nonanamide |
| SMILES | O=C(NCCCCCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H16F34N2O2/c26-10(27,12(30,31)14(34,35)16(38,39)18(42,43)20(46,47)22(50,51)24(54,55)56)8(62)60-6-4-2-1-3-5-7-61-9(63)11(28,29)13(32,33)15(36,37)17(40,41)19(44,45)21(48,49)23(52,53)25(57,58)59/h1-7H2,(H,60,62)(H,61,63) |
| InChIKey | AJHKRSIWZFQOIC-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.35 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|