C17H18F12O8 — CID 175406478
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid;nonanedioic acid (PubChem CID 175406478) has the molecular formula C17H18F12O8 and a molecular weight of 578.30 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid;nonanedioic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid;nonanedioic acid |
|---|---|
| PubChem CID | 175406478 |
| Molecular Formula | C17H18F12O8 |
| Molecular Weight | 578.30 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctanedioic acid;nonanedioic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O.O=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C9H16O4.C8H2F12O4/c10-8(11)6-4-2-1-3-5-7-9(12)13;9-3(10,1(21)22)5(13,14)7(17,18)8(19,20)6(15,16)4(11,12)2(23)24/h1-7H2,(H,10,11)(H,12,13);(H,21,22)(H,23,24) |
| InChIKey | ZCBAFTRYFIQMBX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|