C37H66O16 — CID 159759294
decanedioic acid;tris(nonanedioic acid) (PubChem CID 159759294) has the molecular formula C37H66O16 and a molecular weight of 766.92 g/mol. Its IUPAC name is decanedioic acid;tris(nonanedioic acid).
| Compound Name | decanedioic acid;tris(nonanedioic acid) |
|---|---|
| PubChem CID | 159759294 |
| Molecular Formula | C37H66O16 |
| Molecular Weight | 766.92 g/mol |
| Exact Mass | 766.44 |
| IUPAC Name | decanedioic acid;tris(nonanedioic acid) |
| SMILES | O=C(O)CCCCCCCC(=O)O.O=C(O)CCCCCCCC(=O)O.O=C(O)CCCCCCCC(=O)O.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.3C9H16O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;3*10-8(11)6-4-2-1-3-5-7-9(12)13/h1-8H2,(H,11,12)(H,13,14);3*1-7H2,(H,10,11)(H,12,13) |
| InChIKey | NERBRYRLONKGON-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.92 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|