About octanedioic acid;zinc
octanedioic acid;zinc (PubChem CID 87285694) has the molecular formula C8H14O4Zn
and a molecular weight of 239.59 g/mol. Its IUPAC name is octanedioic acid;zinc.
Molecular Properties
| Compound Name | octanedioic acid;zinc |
| PubChem CID | 87285694 |
| Molecular Formula | C8H14O4Zn |
| Molecular Weight | 239.59 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | octanedioic acid;zinc |
| SMILES | O=C(O)CCCCCCC(=O)O.[Zn] |
| InChI | InChI=1S/C8H14O4.Zn/c9-7(10)5-3-1-2-4-6-8(11)12;/h1-6H2,(H,9,10)(H,11,12); |
| InChIKey | UEOFCEONCFPUFO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.59 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octanedioic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octanedioic acid;zinc?
The IUPAC name of octanedioic acid;zinc (CID 87285694) is octanedioic acid;zinc.
What is the SMILES notation for octanedioic acid;zinc?
The canonical SMILES for octanedioic acid;zinc is O=C(O)CCCCCCC(=O)O.[Zn].
What is the InChIKey of octanedioic acid;zinc?
The InChIKey is UEOFCEONCFPUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.Zn/c9-7(10)5-3-1-2-4-6-8(11)12;/h1-6H2,(H,9,10)(H,11,12);.
What are the key properties of octanedioic acid;zinc?
octanedioic acid;zinc has a molecular weight of 239.59 g/mol, XLogP of 1.49, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octanedioic acid;zinc is sourced from PubChem (CID 87285694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).