C30H56O8 — CID 161217033
decanedioic acid;icosanedioic acid (PubChem CID 161217033) has the molecular formula C30H56O8 and a molecular weight of 544.77 g/mol. Its IUPAC name is decanedioic acid;icosanedioic acid.
| Compound Name | decanedioic acid;icosanedioic acid |
|---|---|
| PubChem CID | 161217033 |
| Molecular Formula | C30H56O8 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | decanedioic acid;icosanedioic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)O.O=C(O)CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O4.C10H18O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-18H2,(H,21,22)(H,23,24);1-8H2,(H,11,12)(H,13,14) |
| InChIKey | UWZSSMVMZXCQRR-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|