C24H44O8 — CID 158333715
tridecanedioic acid;undecanedioic acid (PubChem CID 158333715) has the molecular formula C24H44O8 and a molecular weight of 460.61 g/mol. Its IUPAC name is tridecanedioic acid;undecanedioic acid.
| Compound Name | tridecanedioic acid;undecanedioic acid |
|---|---|
| PubChem CID | 158333715 |
| Molecular Formula | C24H44O8 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | tridecanedioic acid;undecanedioic acid |
| SMILES | O=C(O)CCCCCCCCCC(=O)O.O=C(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H24O4.C11H20O4/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17;12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-11H2,(H,14,15)(H,16,17);1-9H2,(H,12,13)(H,14,15) |
| InChIKey | GQICBDCDZGMJBH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|