About azane;decanedioic acid;nonanedioic acid
azane;decanedioic acid;nonanedioic acid (PubChem CID 174896485) has the molecular formula C19H37NO8
and a molecular weight of 407.50 g/mol. Its IUPAC name is azane;decanedioic acid;nonanedioic acid.
Molecular Properties
| Compound Name | azane;decanedioic acid;nonanedioic acid |
| PubChem CID | 174896485 |
| Molecular Formula | C19H37NO8 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | azane;decanedioic acid;nonanedioic acid |
| SMILES | N.O=C(O)CCCCCCCC(=O)O.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C9H16O4.H3N/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;10-8(11)6-4-2-1-3-5-7-9(12)13;/h1-8H2,(H,11,12)(H,13,14);1-7H2,(H,10,11)(H,12,13);1H3 |
| InChIKey | PNCPZEBBZIOPOS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;decanedioic acid;nonanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;decanedioic acid;nonanedioic acid?
The IUPAC name of azane;decanedioic acid;nonanedioic acid (CID 174896485) is azane;decanedioic acid;nonanedioic acid.
What is the SMILES notation for azane;decanedioic acid;nonanedioic acid?
The canonical SMILES for azane;decanedioic acid;nonanedioic acid is N.O=C(O)CCCCCCCC(=O)O.O=C(O)CCCCCCCCC(=O)O.
What is the InChIKey of azane;decanedioic acid;nonanedioic acid?
The InChIKey is PNCPZEBBZIOPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.C9H16O4.H3N/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;10-8(11)6-4-2-1-3-5-7-9(12)13;/h1-8H2,(H,11,12)(H,13,14);1-7H2,(H,10,11)(H,12,13);1H3.
What are the key properties of azane;decanedioic acid;nonanedioic acid?
azane;decanedioic acid;nonanedioic acid has a molecular weight of 407.50 g/mol, XLogP of 4.32, 17 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;decanedioic acid;nonanedioic acid is sourced from PubChem (CID 174896485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).