About tetradecanedioic acid
tetradecanedioic acid (PubChem CID 13185) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is tetradecanedioic acid.
Molecular Properties
| Compound Name | tetradecanedioic acid |
| PubChem CID | 13185 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | tetradecanedioic acid |
| SMILES | O=C(O)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18) |
| InChIKey | HQHCYKULIHKCEB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecanedioic acid?
The IUPAC name of tetradecanedioic acid (CID 13185) is tetradecanedioic acid.
What is the SMILES notation for tetradecanedioic acid?
The canonical SMILES for tetradecanedioic acid is O=C(O)CCCCCCCCCCCCC(=O)O.
What is the InChIKey of tetradecanedioic acid?
The InChIKey is HQHCYKULIHKCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18).
What are the key properties of tetradecanedioic acid?
tetradecanedioic acid has a molecular weight of 258.36 g/mol, XLogP of 3.84, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecanedioic acid is sourced from PubChem (CID 13185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).