tetradecanedioic acid

C14H26O4 — CID 13185

IUPACtetradecanedioic acid
SMILESO=C(O)CCCCCCCCCCCCC(=O)O
InChIInChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18)
InChIKeyHQHCYKULIHKCEB-UHFFFAOYSA-N
MW258.36 g/mol
LogP3.84
Rot. Bonds13

About tetradecanedioic acid

tetradecanedioic acid (PubChem CID 13185) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is tetradecanedioic acid.

Molecular Properties

Compound Nametetradecanedioic acid
PubChem CID13185
Molecular FormulaC14H26O4
Molecular Weight258.36 g/mol
Exact Mass258.18
IUPAC Nametetradecanedioic acid
SMILESO=C(O)CCCCCCCCCCCCC(=O)O
InChIInChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18)
InChIKeyHQHCYKULIHKCEB-UHFFFAOYSA-N
XLogP3.84
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds13
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 53.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze tetradecanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tetradecanedioic acid?
The IUPAC name of tetradecanedioic acid (CID 13185) is tetradecanedioic acid.
What is the SMILES notation for tetradecanedioic acid?
The canonical SMILES for tetradecanedioic acid is O=C(O)CCCCCCCCCCCCC(=O)O.
What is the InChIKey of tetradecanedioic acid?
The InChIKey is HQHCYKULIHKCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18).
What are the key properties of tetradecanedioic acid?
tetradecanedioic acid has a molecular weight of 258.36 g/mol, XLogP of 3.84, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecanedioic acid is sourced from PubChem (CID 13185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).