C24H42O12 — CID 159110511
decanedioic acid;hexanedioic acid;octanedioic acid (PubChem CID 159110511) has the molecular formula C24H42O12 and a molecular weight of 522.59 g/mol. Its IUPAC name is decanedioic acid;hexanedioic acid;octanedioic acid.
| Compound Name | decanedioic acid;hexanedioic acid;octanedioic acid |
|---|---|
| PubChem CID | 159110511 |
| Molecular Formula | C24H42O12 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | decanedioic acid;hexanedioic acid;octanedioic acid |
| SMILES | O=C(O)CCCCC(=O)O.O=C(O)CCCCCCC(=O)O.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C8H14O4.C6H10O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;9-7(10)5-3-1-2-4-6-8(11)12;7-5(8)3-1-2-4-6(9)10/h1-8H2,(H,11,12)(H,13,14);1-6H2,(H,9,10)(H,11,12);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | KEKRJAGVFVDEJI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|