C13H20F6N2O4 — CID 648321
2,2,3,3,4,4-hexafluoro-N,N'-bis(4-hydroxybutyl)pentanediamide (PubChem CID 648321) has the molecular formula C13H20F6N2O4 and a molecular weight of 382.30 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-N,N'-bis(4-hydroxybutyl)pentanediamide.
| Compound Name | 2,2,3,3,4,4-hexafluoro-N,N'-bis(4-hydroxybutyl)pentanediamide |
|---|---|
| PubChem CID | 648321 |
| Molecular Formula | C13H20F6N2O4 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-N,N'-bis(4-hydroxybutyl)pentanediamide |
| SMILES | O=C(NCCCCO)C(F)(F)C(F)(F)C(F)(F)C(=O)NCCCCO |
| InChI | InChI=1S/C13H20F6N2O4/c14-11(15,9(24)20-5-1-3-7-22)13(18,19)12(16,17)10(25)21-6-2-4-8-23/h22-23H,1-8H2,(H,20,24)(H,21,25) |
| InChIKey | YMIYMFBPMMRMNM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|