C10H6ClF14NO2 — CID 3090460
8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(2-hydroxyethyl)octanamide (PubChem CID 3090460) has the molecular formula C10H6ClF14NO2 and a molecular weight of 473.59 g/mol. Its IUPAC name is 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(2-hydroxyethyl)octanamide.
| Compound Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(2-hydroxyethyl)octanamide |
|---|---|
| PubChem CID | 3090460 |
| Molecular Formula | C10H6ClF14NO2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(2-hydroxyethyl)octanamide |
| SMILES | O=C(NCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C10H6ClF14NO2/c11-10(24,25)9(22,23)8(20,21)7(18,19)6(16,17)5(14,15)4(12,13)3(28)26-1-2-27/h27H,1-2H2,(H,26,28) |
| InChIKey | UEDWJSWTFWVYDY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|