C13H12ClF14NO — CID 5227176
8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methylbutyl)octanamide (PubChem CID 5227176) has the molecular formula C13H12ClF14NO and a molecular weight of 499.67 g/mol. Its IUPAC name is 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methylbutyl)octanamide.
| Compound Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methylbutyl)octanamide |
|---|---|
| PubChem CID | 5227176 |
| Molecular Formula | C13H12ClF14NO |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-(3-methylbutyl)octanamide |
| SMILES | CC(C)CCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C13H12ClF14NO/c1-5(2)3-4-29-6(30)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(14,27)28/h5H,3-4H2,1-2H3,(H,29,30) |
| InChIKey | TWEUGBCFXALXIH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|