C9H8ClF10NO2 — CID 3532120
6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(3-hydroxypropyl)hexanamide (PubChem CID 3532120) has the molecular formula C9H8ClF10NO2 and a molecular weight of 387.60 g/mol. Its IUPAC name is 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(3-hydroxypropyl)hexanamide.
| Compound Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(3-hydroxypropyl)hexanamide |
|---|---|
| PubChem CID | 3532120 |
| Molecular Formula | C9H8ClF10NO2 |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N-(3-hydroxypropyl)hexanamide |
| SMILES | O=C(NCCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C9H8ClF10NO2/c10-9(19,20)8(17,18)7(15,16)6(13,14)5(11,12)4(23)21-2-1-3-22/h22H,1-3H2,(H,21,23) |
| InChIKey | GRXLVLWKOLWGQA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|