C8H9F8NO2 — CID 4047638
2,2,3,3,4,4,5,5-octafluoro-N-(3-hydroxypropyl)pentanamide (PubChem CID 4047638) has the molecular formula C8H9F8NO2 and a molecular weight of 303.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N-(3-hydroxypropyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N-(3-hydroxypropyl)pentanamide |
|---|---|
| PubChem CID | 4047638 |
| Molecular Formula | C8H9F8NO2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N-(3-hydroxypropyl)pentanamide |
| SMILES | O=C(NCCCO)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H9F8NO2/c9-4(10)6(11,12)8(15,16)7(13,14)5(19)17-2-1-3-18/h4,18H,1-3H2,(H,17,19) |
| InChIKey | IRRRMIPQWYJVLV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|