C7H7F8NOS — CID 6425964
2,2,3,3,4,4,5,5-octafluoro-N-(2-hydroxyethyl)pentanethioamide (PubChem CID 6425964) has the molecular formula C7H7F8NOS and a molecular weight of 305.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N-(2-hydroxyethyl)pentanethioamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N-(2-hydroxyethyl)pentanethioamide |
|---|---|
| PubChem CID | 6425964 |
| Molecular Formula | C7H7F8NOS |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N-(2-hydroxyethyl)pentanethioamide |
| SMILES | OCCNC(=S)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H7F8NOS/c8-3(9)5(10,11)7(14,15)6(12,13)4(18)16-1-2-17/h3,17H,1-2H2,(H,16,18) |
| InChIKey | XNPMLQRMKRITKM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|