azane;2-hydroxyethylcarbamodithioic acid

C3H10N2OS2 — CID 170844330

IUPACazane;2-hydroxyethylcarbamodithioic acid
SMILESN.OCCNC(=S)S
InChIInChI=1S/C3H7NOS2.H3N/c5-2-1-4-3(6)7;/h5H,1-2H2,(H2,4,6,7);1H3
InChIKeySHACSWKUQPMRMW-UHFFFAOYSA-N
MW154.26 g/mol
LogP-0.05
Rot. Bonds2

About azane;2-hydroxyethylcarbamodithioic acid

azane;2-hydroxyethylcarbamodithioic acid (PubChem CID 170844330) has the molecular formula C3H10N2OS2 and a molecular weight of 154.26 g/mol. Its IUPAC name is azane;2-hydroxyethylcarbamodithioic acid.

Molecular Properties

Compound Nameazane;2-hydroxyethylcarbamodithioic acid
PubChem CID170844330
Molecular FormulaC3H10N2OS2
Molecular Weight154.26 g/mol
Exact Mass154.02
IUPAC Nameazane;2-hydroxyethylcarbamodithioic acid
SMILESN.OCCNC(=S)S
InChIInChI=1S/C3H7NOS2.H3N/c5-2-1-4-3(6)7;/h5H,1-2H2,(H2,4,6,7);1H3
InChIKeySHACSWKUQPMRMW-UHFFFAOYSA-N
XLogP-0.05
TPSA67.26 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.26
LogP ≤ 5-0.05
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze azane;2-hydroxyethylcarbamodithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-hydroxyethylcarbamodithioic acid?
The IUPAC name of azane;2-hydroxyethylcarbamodithioic acid (CID 170844330) is azane;2-hydroxyethylcarbamodithioic acid.
What is the SMILES notation for azane;2-hydroxyethylcarbamodithioic acid?
The canonical SMILES for azane;2-hydroxyethylcarbamodithioic acid is N.OCCNC(=S)S.
What is the InChIKey of azane;2-hydroxyethylcarbamodithioic acid?
The InChIKey is SHACSWKUQPMRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NOS2.H3N/c5-2-1-4-3(6)7;/h5H,1-2H2,(H2,4,6,7);1H3.
What are the key properties of azane;2-hydroxyethylcarbamodithioic acid?
azane;2-hydroxyethylcarbamodithioic acid has a molecular weight of 154.26 g/mol, XLogP of -0.05, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxyethylcarbamodithioic acid is sourced from PubChem (CID 170844330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).