C6H2F14O — CID 174966166
trifluoromethanol;1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane (PubChem CID 174966166) has the molecular formula C6H2F14O and a molecular weight of 356.05 g/mol. Its IUPAC name is trifluoromethanol;1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane.
| Compound Name | trifluoromethanol;1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane |
|---|---|
| PubChem CID | 174966166 |
| Molecular Formula | C6H2F14O |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | trifluoromethanol;1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OC(F)(F)F |
| InChI | InChI=1S/C5HF11.CHF3O/c6-1(7)2(8,9)3(10,11)4(12,13)5(14,15)16;2-1(3,4)5/h1H;5H |
| InChIKey | COCIQLVNXMTPCQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|