C10H3F19O2 — CID 174974760
1,1,2,2,3,4,4,5,5,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecane-3,6-diol (PubChem CID 174974760) has the molecular formula C10H3F19O2 and a molecular weight of 516.09 g/mol. Its IUPAC name is 1,1,2,2,3,4,4,5,5,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecane-3,6-diol.
| Compound Name | 1,1,2,2,3,4,4,5,5,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecane-3,6-diol |
|---|---|
| PubChem CID | 174974760 |
| Molecular Formula | C10H3F19O2 |
| Molecular Weight | 516.09 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 1,1,2,2,3,4,4,5,5,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecane-3,6-diol |
| SMILES | OC(F)(C(F)(F)C(F)F)C(F)(F)C(F)(F)C(O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H3F19O2/c11-1(12)2(13,14)8(25,30)5(19,20)6(21,22)9(26,31)4(17,18)3(15,16)7(23,24)10(27,28)29/h1,30-31H |
| InChIKey | HXPLMCMALMAZKA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.09 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|