C8H3F15O2 — CID 54146634
1,1,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctane-1,2-diol (PubChem CID 54146634) has the molecular formula C8H3F15O2 and a molecular weight of 416.08 g/mol. Its IUPAC name is 1,1,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctane-1,2-diol.
| Compound Name | 1,1,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctane-1,2-diol |
|---|---|
| PubChem CID | 54146634 |
| Molecular Formula | C8H3F15O2 |
| Molecular Weight | 416.08 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 1,1,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctane-1,2-diol |
| SMILES | OC(C(O)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F15O2/c9-2(10,1(24)3(11,12)25)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h1,24-25H |
| InChIKey | OEVREUMZWQYSGO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|