C6H2F13Na — CID 173105318
sodium;hydride;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane (PubChem CID 173105318) has the molecular formula C6H2F13Na and a molecular weight of 344.05 g/mol. Its IUPAC name is sodium;hydride;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane.
| Compound Name | sodium;hydride;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane |
|---|---|
| PubChem CID | 173105318 |
| Molecular Formula | C6H2F13Na |
| Molecular Weight | 344.05 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | sodium;hydride;1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C6HF13.Na.H/c7-1(8)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)19;;/h1H;;/q;+1;-1 |
| InChIKey | LMFBWGWVGRJRGP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.05 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|