C9H4F17N — CID 87467900
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononan-1-amine (PubChem CID 87467900) has the molecular formula C9H4F17N and a molecular weight of 449.10 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononan-1-amine.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononan-1-amine |
|---|---|
| PubChem CID | 87467900 |
| Molecular Formula | C9H4F17N |
| Molecular Weight | 449.10 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-heptadecafluorononan-1-amine |
| SMILES | NC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H4F17N/c10-1(11)3(13,14)5(17,18)7(21,22)9(25,26)8(23,24)6(19,20)4(15,16)2(12)27/h1-2H,27H2 |
| InChIKey | VZUGCWJIPBWJMH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.10 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|