C8H4F14O — CID 2776291
2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol (PubChem CID 2776291) has the molecular formula C8H4F14O and a molecular weight of 382.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol |
|---|---|
| PubChem CID | 2776291 |
| Molecular Formula | C8H4F14O |
| Molecular Weight | 382.09 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H4F14O/c9-2(10)4(13,14)6(17,18)8(21,22)7(19,20)5(15,16)3(11,12)1-23/h2,23H,1H2 |
| InChIKey | ISIIJJQHILZBPB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|