C9H9F12S — CID 16557800
CID 16557800 (PubChem CID 16557800) has the molecular formula C9H9F12S and a molecular weight of 377.21 g/mol.
| Compound Name | CID 16557800 |
|---|---|
| PubChem CID | 16557800 |
| Molecular Formula | C9H9F12S |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | — |
| SMILES | C[S](C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F12S/c1-22(2)3-5(12,13)7(16,17)9(20,21)8(18,19)6(14,15)4(10)11/h4H,3H2,1-2H3 |
| InChIKey | QRKGWTKWBFQGTK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|