C8H6F12 — CID 163290381
1,1,2,2,3,3,4,4,5,5,7,7-dodecafluorooctane (PubChem CID 163290381) has the molecular formula C8H6F12 and a molecular weight of 330.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,7,7-dodecafluorooctane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,7,7-dodecafluorooctane |
|---|---|
| PubChem CID | 163290381 |
| Molecular Formula | C8H6F12 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,7,7-dodecafluorooctane |
| SMILES | CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H6F12/c1-4(11,12)2-5(13,14)7(17,18)8(19,20)6(15,16)3(9)10/h3H,2H2,1H3 |
| InChIKey | YHODOAIITKFYFM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|