C11H5F17O — CID 19812630
2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-heptadecafluoroundecanal (PubChem CID 19812630) has the molecular formula C11H5F17O and a molecular weight of 476.13 g/mol. Its IUPAC name is 2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-heptadecafluoroundecanal.
| Compound Name | 2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-heptadecafluoroundecanal |
|---|---|
| PubChem CID | 19812630 |
| Molecular Formula | C11H5F17O |
| Molecular Weight | 476.13 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-heptadecafluoroundecanal |
| SMILES | O=CC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H5F17O/c12-3(2-29)1-5(15,16)7(19,20)9(23,24)11(27,28)10(25,26)8(21,22)6(17,18)4(13)14/h2-4H,1H2 |
| InChIKey | ZOOIMPUACSAIAN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.13 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|