C18H8F24O4 — CID 73182527
bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) but-2-enedioate (PubChem CID 73182527) has the molecular formula C18H8F24O4 and a molecular weight of 744.21 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) but-2-enedioate.
| Compound Name | bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) but-2-enedioate |
|---|---|
| PubChem CID | 73182527 |
| Molecular Formula | C18H8F24O4 |
| Molecular Weight | 744.21 g/mol |
| Exact Mass | 744.00 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) but-2-enedioate |
| SMILES | O=C(C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H8F24O4/c19-7(20)11(27,28)15(35,36)17(39,40)13(31,32)9(23,24)3-45-5(43)1-2-6(44)46-4-10(25,26)14(33,34)18(41,42)16(37,38)12(29,30)8(21)22/h1-2,7-8H,3-4H2 |
| InChIKey | DZWVZROPVHQUKK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.21 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|