C18H24F8O5 — CID 91712861
1-O-[2-(2-methoxyethyl)hexyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate (PubChem CID 91712861) has the molecular formula C18H24F8O5 and a molecular weight of 472.37 g/mol. Its IUPAC name is 1-O-[2-(2-methoxyethyl)hexyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate.
| Compound Name | 1-O-[2-(2-methoxyethyl)hexyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91712861 |
| Molecular Formula | C18H24F8O5 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-O-[2-(2-methoxyethyl)hexyl] 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) (E)-but-2-enedioate |
| SMILES | CCCCC(CCOC)COC(=O)/C=C/C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H24F8O5/c1-3-4-5-12(8-9-29-2)10-30-13(27)6-7-14(28)31-11-16(21,22)18(25,26)17(23,24)15(19)20/h6-7,12,15H,3-5,8-11H2,1-2H3/b7-6+ |
| InChIKey | GYNNJQIEDIQPAY-VOTSOKGWSA-N |
| XLogP | 4.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|