C21H32F8O4 — CID 91744719
1-O-hexyl 10-O-(2,2,3,3,4,4,5,5-octafluoropentyl) decanedioate (PubChem CID 91744719) has the molecular formula C21H32F8O4 and a molecular weight of 500.47 g/mol. Its IUPAC name is 1-O-hexyl 10-O-(2,2,3,3,4,4,5,5-octafluoropentyl) decanedioate.
| Compound Name | 1-O-hexyl 10-O-(2,2,3,3,4,4,5,5-octafluoropentyl) decanedioate |
|---|---|
| PubChem CID | 91744719 |
| Molecular Formula | C21H32F8O4 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-O-hexyl 10-O-(2,2,3,3,4,4,5,5-octafluoropentyl) decanedioate |
| SMILES | CCCCCCOC(=O)CCCCCCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H32F8O4/c1-2-3-4-11-14-32-16(30)12-9-7-5-6-8-10-13-17(31)33-15-19(24,25)21(28,29)20(26,27)18(22)23/h18H,2-15H2,1H3 |
| InChIKey | MQPWDHUQOFKIFV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|