C12H14F8O4 — CID 91742836
1-O-ethyl 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91742836) has the molecular formula C12H14F8O4 and a molecular weight of 374.22 g/mol. Its IUPAC name is 1-O-ethyl 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-ethyl 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91742836 |
| Molecular Formula | C12H14F8O4 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 1-O-ethyl 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | CCOC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H14F8O4/c1-2-23-7(21)4-3-5-8(22)24-6-10(15,16)12(19,20)11(17,18)9(13)14/h9H,2-6H2,1H3 |
| InChIKey | XIGICNZSYKZAPH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|