C14H18F8O4 — CID 91742261
1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-pentan-2-yl butanedioate (PubChem CID 91742261) has the molecular formula C14H18F8O4 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-pentan-2-yl butanedioate.
| Compound Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-pentan-2-yl butanedioate |
|---|---|
| PubChem CID | 91742261 |
| Molecular Formula | C14H18F8O4 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 4-O-pentan-2-yl butanedioate |
| SMILES | CCCC(C)OC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H18F8O4/c1-3-4-8(2)26-10(24)6-5-9(23)25-7-12(17,18)14(21,22)13(19,20)11(15)16/h8,11H,3-7H2,1-2H3 |
| InChIKey | NGHKANPFEYCOCN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|