C16H22F8O4 — CID 91742871
1-O-(2-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91742871) has the molecular formula C16H22F8O4 and a molecular weight of 430.33 g/mol. Its IUPAC name is 1-O-(2-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 1-O-(2-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91742871 |
| Molecular Formula | C16H22F8O4 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-O-(2-methylpentyl) 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | CCCC(C)COC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H22F8O4/c1-3-5-10(2)8-27-11(25)6-4-7-12(26)28-9-14(19,20)16(23,24)15(21,22)13(17)18/h10,13H,3-9H2,1-2H3 |
| InChIKey | MCVNBCCERZSJKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|