C15H20F8O4 — CID 91742791
5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-pentyl pentanedioate (PubChem CID 91742791) has the molecular formula C15H20F8O4 and a molecular weight of 416.31 g/mol. Its IUPAC name is 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-pentyl pentanedioate.
| Compound Name | 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-pentyl pentanedioate |
|---|---|
| PubChem CID | 91742791 |
| Molecular Formula | C15H20F8O4 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-pentyl pentanedioate |
| SMILES | CCCCCOC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H20F8O4/c1-2-3-4-8-26-10(24)6-5-7-11(25)27-9-13(18,19)15(22,23)14(20,21)12(16)17/h12H,2-9H2,1H3 |
| InChIKey | GVIRVDFWJDAGNE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|