C14H10F16O4 — CID 22373366
bis(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 22373366) has the molecular formula C14H10F16O4 and a molecular weight of 546.20 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | bis(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 22373366 |
| Molecular Formula | C14H10F16O4 |
| Molecular Weight | 546.20 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H10F16O4/c15-7(16)11(23,24)13(27,28)9(19,20)3-33-5(31)1-2-6(32)34-4-10(21,22)14(29,30)12(25,26)8(17)18/h7-8H,1-4H2 |
| InChIKey | BMUSAZHBEYJSHP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.20 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|