C16H9F13O4 — CID 91727709
4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(2,3,4,5,6-pentafluorophenyl)methyl] butanedioate (PubChem CID 91727709) has the molecular formula C16H9F13O4 and a molecular weight of 512.22 g/mol. Its IUPAC name is 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(2,3,4,5,6-pentafluorophenyl)methyl] butanedioate.
| Compound Name | 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(2,3,4,5,6-pentafluorophenyl)methyl] butanedioate |
|---|---|
| PubChem CID | 91727709 |
| Molecular Formula | C16H9F13O4 |
| Molecular Weight | 512.22 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(2,3,4,5,6-pentafluorophenyl)methyl] butanedioate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H9F13O4/c17-8-5(9(18)11(20)12(21)10(8)19)3-32-6(30)1-2-7(31)33-4-14(24,25)16(28,29)15(26,27)13(22)23/h13H,1-4H2 |
| InChIKey | NITFPYAZMCLHLU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.22 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|