C15H10Cl2F8O4 — CID 91742217
4-O-(2,6-dichlorophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91742217) has the molecular formula C15H10Cl2F8O4 and a molecular weight of 477.13 g/mol. Its IUPAC name is 4-O-(2,6-dichlorophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 4-O-(2,6-dichlorophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91742217 |
| Molecular Formula | C15H10Cl2F8O4 |
| Molecular Weight | 477.13 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | 4-O-(2,6-dichlorophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1c(Cl)cccc1Cl)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H10Cl2F8O4/c16-7-2-1-3-8(17)11(7)29-10(27)5-4-9(26)28-6-13(20,21)15(24,25)14(22,23)12(18)19/h1-3,12H,4-6H2 |
| InChIKey | IYSBFXZVGJRTSA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.13 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|