C17H16F8O5 — CID 91715938
4-O-(2-methoxy-5-methylphenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91715938) has the molecular formula C17H16F8O5 and a molecular weight of 452.29 g/mol. Its IUPAC name is 4-O-(2-methoxy-5-methylphenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 4-O-(2-methoxy-5-methylphenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91715938 |
| Molecular Formula | C17H16F8O5 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-O-(2-methoxy-5-methylphenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | COc1ccc(C)cc1OC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H16F8O5/c1-9-3-4-10(28-2)11(7-9)30-13(27)6-5-12(26)29-8-15(20,21)17(24,25)16(22,23)14(18)19/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | KELUEXLJGVBASS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|