C14H16F4O3 — CID 103473738
1-(2-methoxy-5-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473738) has the molecular formula C14H16F4O3 and a molecular weight of 308.27 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473738 |
| Molecular Formula | C14H16F4O3 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | COc1ccc(C)cc1CC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H16F4O3/c1-9-3-4-12(20-2)10(5-9)6-11(19)7-21-8-14(17,18)13(15)16/h3-5,13H,6-8H2,1-2H3 |
| InChIKey | OBGWUPLIFXODEC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|