C14H17F3O3 — CID 103146844
1-(2-methoxy-5-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one (PubChem CID 103146844) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 103146844 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
| SMILES | COc1ccc(C)cc1CC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C14H17F3O3/c1-10-3-4-13(19-2)11(7-10)8-12(18)5-6-20-9-14(15,16)17/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | QZPGGIZQPSXJFD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|