C13H15F3O2 — CID 113229487
1-(2-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one (PubChem CID 113229487) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-(2-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one.
| Compound Name | 1-(2-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 113229487 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(2-methylphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
| SMILES | Cc1ccccc1CC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C13H15F3O2/c1-10-4-2-3-5-11(10)8-12(17)6-7-18-9-13(14,15)16/h2-5H,6-9H2,1H3 |
| InChIKey | JXLAJYFJWRDHGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|