C12H11BrF4O2 — CID 103146759
1-(5-bromo-2-fluorophenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one (PubChem CID 103146759) has the molecular formula C12H11BrF4O2 and a molecular weight of 343.11 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 103146759 |
| Molecular Formula | C12H11BrF4O2 |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
| SMILES | O=C(CCOCC(F)(F)F)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H11BrF4O2/c13-9-1-2-11(14)8(5-9)6-10(18)3-4-19-7-12(15,16)17/h1-2,5H,3-4,6-7H2 |
| InChIKey | QCVXAKNDHCRURI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|