C13H14BrF4NO2 — CID 134005406
N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 134005406) has the molecular formula C13H14BrF4NO2 and a molecular weight of 372.16 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 134005406 |
| Molecular Formula | C13H14BrF4NO2 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C13H14BrF4NO2/c1-19(7-9-6-10(14)2-3-11(9)15)12(20)4-5-21-8-13(16,17)18/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | JJWQACIHRGQREI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|