C13H14BrF3O3 — CID 103146880
1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one (PubChem CID 103146880) has the molecular formula C13H14BrF3O3 and a molecular weight of 355.15 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 103146880 |
| Molecular Formula | C13H14BrF3O3 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-one |
| SMILES | COc1ccc(Br)cc1CC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C13H14BrF3O3/c1-19-12-3-2-10(14)6-9(12)7-11(18)4-5-20-8-13(15,16)17/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | GISFUMLYHCTHAB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|